C30H22ClN7O4 — CID 168572448
2-[2-[[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-ethoxyphenyl]methylidene]hydrazinyl]-4-hydroxy-6-phenylpyrimidine-5-carbonitrile (PubChem CID 168572448) has the molecular formula C30H22ClN7O4 and a molecular weight of 580.00 g/mol. Its IUPAC name is 2-[2-[[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-ethoxyphenyl]methylidene]hydrazinyl]-4-hydroxy-6-phenylpyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-ethoxyphenyl]methylidene]hydrazinyl]-4-hydroxy-6-phenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572448 |
| Molecular Formula | C30H22ClN7O4 |
| Molecular Weight | 580.00 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 2-[2-[[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-ethoxyphenyl]methylidene]hydrazinyl]-4-hydroxy-6-phenylpyrimidine-5-carbonitrile |
| SMILES | CCOc1cc(C=NNc2nc(O)c(C#N)c(-c3ccccc3)n2)ccc1Oc1cnn(-c2ccccc2)c(=O)c1Cl |
| InChI | InChI=1S/C30H22ClN7O4/c1-2-41-24-15-19(17-33-37-30-35-27(20-9-5-3-6-10-20)22(16-32)28(39)36-30)13-14-23(24)42-25-18-34-38(29(40)26(25)31)21-11-7-4-8-12-21/h3-15,17-18H,2H2,1H3,(H2,35,36,37,39) |
| InChIKey | ZKXQIFWEPTVPOR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.00 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|