C22H23ClN4O4 — CID 110512634
4-chloro-5-[(2Z)-2-[(3,4-diethoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one (PubChem CID 110512634) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 4-chloro-5-[(2Z)-2-[(3,4-diethoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(2Z)-2-[(3,4-diethoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 110512634 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-chloro-5-[(2Z)-2-[(3,4-diethoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one |
| SMILES | CCOc1ccc(/C=N\Nc2cnn(-c3ccc(OC)cc3)c(=O)c2Cl)cc1OCC |
| InChI | InChI=1S/C22H23ClN4O4/c1-4-30-19-11-6-15(12-20(19)31-5-2)13-24-26-18-14-25-27(22(28)21(18)23)16-7-9-17(29-3)10-8-16/h6-14,26H,4-5H2,1-3H3/b24-13- |
| InChIKey | VTBHHMHVOIEFNH-CFRMEGHHSA-N |
| XLogP | 4.14 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|