C20H18ClN5O5 — CID 110512559
4-chloro-5-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one (PubChem CID 110512559) has the molecular formula C20H18ClN5O5 and a molecular weight of 443.85 g/mol. Its IUPAC name is 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 110512559 |
| Molecular Formula | C20H18ClN5O5 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
| SMILES | CCOc1cc(/C=N\Nc2cnn(-c3ccccc3)c(=O)c2Cl)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C20H18ClN5O5/c1-3-31-17-10-13(9-16(26(28)29)19(17)30-2)11-22-24-15-12-23-25(20(27)18(15)21)14-7-5-4-6-8-14/h4-12,24H,3H2,1-2H3/b22-11- |
| InChIKey | MSIGOFXMPXQVJM-JJFYIABZSA-N |
| XLogP | 3.65 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|