C17H12ClN5O5 — CID 136733177
4-chloro-5-[(2E)-2-[(2,4-dihydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one (PubChem CID 136733177) has the molecular formula C17H12ClN5O5 and a molecular weight of 401.77 g/mol. Its IUPAC name is 4-chloro-5-[(2E)-2-[(2,4-dihydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(2E)-2-[(2,4-dihydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 136733177 |
| Molecular Formula | C17H12ClN5O5 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 4-chloro-5-[(2E)-2-[(2,4-dihydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(N/N=C/c2cc([N+](=O)[O-])c(O)cc2O)cnn1-c1ccccc1 |
| InChI | InChI=1S/C17H12ClN5O5/c18-16-12(9-20-22(17(16)26)11-4-2-1-3-5-11)21-19-8-10-6-13(23(27)28)15(25)7-14(10)24/h1-9,21,24-25H/b19-8+ |
| InChIKey | ORPYNKAHTMVLAR-UFWORHAWSA-N |
| XLogP | 2.65 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|