C16H12ClN4O — CID 72701644
CID 72701644 (PubChem CID 72701644) has the molecular formula C16H12ClN4O and a molecular weight of 311.75 g/mol.
| Compound Name | CID 72701644 |
|---|---|
| PubChem CID | 72701644 |
| Molecular Formula | C16H12ClN4O |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | — |
| SMILES | O=c1c(Cl)c(N/N=C/[C]2[CH][CH][CH][CH]2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C16H12ClN4O/c17-15-14(20-18-10-12-6-4-5-7-12)11-19-21(16(15)22)13-8-2-1-3-9-13/h1-11,20H/b18-10+ |
| InChIKey | KRWQIMNPEPGKEH-VCHYOVAHSA-N |
| XLogP | 2.69 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|