About CID 72701644
CID 72701644 (PubChem CID 72701644) has the molecular formula C16H12ClN4O
and a molecular weight of 311.75 g/mol.
Molecular Properties
| Compound Name | CID 72701644 |
| PubChem CID | 72701644 |
| Molecular Formula | C16H12ClN4O |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | — |
| SMILES | O=c1c(Cl)c(N/N=C/[C]2[CH][CH][CH][CH]2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C16H12ClN4O/c17-15-14(20-18-10-12-6-4-5-7-12)11-19-21(16(15)22)13-8-2-1-3-9-13/h1-11,20H/b18-10+ |
| InChIKey | KRWQIMNPEPGKEH-VCHYOVAHSA-N |
| XLogP | 2.69 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 72701644 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72701644?
The IUPAC name of CID 72701644 (CID 72701644) is not available.
What is the SMILES notation for CID 72701644?
The canonical SMILES for CID 72701644 is O=c1c(Cl)c(N/N=C/[C]2[CH][CH][CH][CH]2)cnn1-c1ccccc1.
What is the InChIKey of CID 72701644?
The InChIKey is KRWQIMNPEPGKEH-VCHYOVAHSA-N. The full InChI is InChI=1S/C16H12ClN4O/c17-15-14(20-18-10-12-6-4-5-7-12)11-19-21(16(15)22)13-8-2-1-3-9-13/h1-11,20H/b18-10+.
What are the key properties of CID 72701644?
CID 72701644 has a molecular weight of 311.75 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72701644 is sourced from PubChem (CID 72701644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).