C17H13ClN4O3 — CID 136787504
4-chloro-5-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one (PubChem CID 136787504) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 4-chloro-5-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 136787504 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-chloro-5-[(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylpyridazin-3-one |
| SMILES | O=c1c(Cl)c(N/N=C\c2ccc(O)c(O)c2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-16-13(21-19-9-11-6-7-14(23)15(24)8-11)10-20-22(17(16)25)12-4-2-1-3-5-12/h1-10,21,23-24H/b19-9- |
| InChIKey | ZVKDLLDROKZRPX-OCKHKDLRSA-N |
| XLogP | 2.74 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|