C18H14BrClN4O3 — CID 112538291
5-[(2Z)-2-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one (PubChem CID 112538291) has the molecular formula C18H14BrClN4O3 and a molecular weight of 449.69 g/mol. Its IUPAC name is 5-[(2Z)-2-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one.
| Compound Name | 5-[(2Z)-2-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 112538291 |
| Molecular Formula | C18H14BrClN4O3 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 5-[(2Z)-2-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-4-chloro-2-phenylpyridazin-3-one |
| SMILES | COc1ccc(/C=N\Nc2cnn(-c3ccccc3)c(=O)c2Cl)c(Br)c1O |
| InChI | InChI=1S/C18H14BrClN4O3/c1-27-14-8-7-11(15(19)17(14)25)9-21-23-13-10-22-24(18(26)16(13)20)12-5-3-2-4-6-12/h2-10,23,25H,1H3/b21-9- |
| InChIKey | DKVWNMFPIWYSJK-NKVSQWTQSA-N |
| XLogP | 3.81 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|