C23H25ClN4O4 — CID 110512606
4-chloro-5-[(2Z)-2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one (PubChem CID 110512606) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 110512606 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-chloro-5-[(2Z)-2-[(3-ethoxy-4-propoxyphenyl)methylidene]hydrazinyl]-2-(4-methoxyphenyl)pyridazin-3-one |
| SMILES | CCCOc1ccc(/C=N\Nc2cnn(-c3ccc(OC)cc3)c(=O)c2Cl)cc1OCC |
| InChI | InChI=1S/C23H25ClN4O4/c1-4-12-32-20-11-6-16(13-21(20)31-5-2)14-25-27-19-15-26-28(23(29)22(19)24)17-7-9-18(30-3)10-8-17/h6-11,13-15,27H,4-5,12H2,1-3H3/b25-14- |
| InChIKey | UVGKXSLSJPWUGP-QFEZKATASA-N |
| XLogP | 4.53 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|