C20H23O4+ — CID 58000822
[5-[(E)-4-(3,4-dimethoxyphenyl)but-2-enyl]-2-methoxyphenyl]-methylideneoxidanium (PubChem CID 58000822) has the molecular formula C20H23O4+ and a molecular weight of 327.40 g/mol. Its IUPAC name is [5-[(E)-4-(3,4-dimethoxyphenyl)but-2-enyl]-2-methoxyphenyl]-methylideneoxidanium.
| Compound Name | [5-[(E)-4-(3,4-dimethoxyphenyl)but-2-enyl]-2-methoxyphenyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 58000822 |
| Molecular Formula | C20H23O4+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [5-[(E)-4-(3,4-dimethoxyphenyl)but-2-enyl]-2-methoxyphenyl]-methylideneoxidanium |
| SMILES | C=[O+]c1cc(C/C=C/Cc2ccc(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C20H23O4/c1-21-17-11-9-15(13-19(17)23-3)7-5-6-8-16-10-12-18(22-2)20(14-16)24-4/h5-6,9-14H,3,7-8H2,1-2,4H3/q+1/b6-5+ |
| InChIKey | QTBRXABPGQSDJM-AATRIKPKSA-N |
| XLogP | 4.13 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|