C23H26O8 — CID 71699167
3-(3,4-dimethoxyphenyl)-2-[(E)-4-(3,4-dimethoxyphenyl)but-2-enoyl]oxypropanoic acid (PubChem CID 71699167) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(3,4-dimethoxyphenyl)but-2-enoyl]oxypropanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(3,4-dimethoxyphenyl)but-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 71699167 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(3,4-dimethoxyphenyl)but-2-enoyl]oxypropanoic acid |
| SMILES | COc1ccc(C/C=C/C(=O)OC(Cc2ccc(OC)c(OC)c2)C(=O)O)cc1OC |
| InChI | InChI=1S/C23H26O8/c1-27-17-10-8-15(12-19(17)29-3)6-5-7-22(24)31-21(23(25)26)14-16-9-11-18(28-2)20(13-16)30-4/h5,7-13,21H,6,14H2,1-4H3,(H,25,26)/b7-5+ |
| InChIKey | MDHCBDSORIUFNR-FNORWQNLSA-N |
| XLogP | 3.06 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|