C22H24O7 — CID 71699165
3-(3,4-dimethoxyphenyl)-2-[(E)-4-(4-methoxyphenyl)but-2-enoyl]oxypropanoic acid (PubChem CID 71699165) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(4-methoxyphenyl)but-2-enoyl]oxypropanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(4-methoxyphenyl)but-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 71699165 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-[(E)-4-(4-methoxyphenyl)but-2-enoyl]oxypropanoic acid |
| SMILES | COc1ccc(C/C=C/C(=O)OC(Cc2ccc(OC)c(OC)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H24O7/c1-26-17-10-7-15(8-11-17)5-4-6-21(23)29-20(22(24)25)14-16-9-12-18(27-2)19(13-16)28-3/h4,6-13,20H,5,14H2,1-3H3,(H,24,25)/b6-4+ |
| InChIKey | LQVYIBRNNFYYRH-GQCTYLIASA-N |
| XLogP | 3.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|