C19H34NO+ — CID 7553123
[(3S)-3-(furan-2-yl)-6-methylheptyl]-(4-methylcyclohexyl)azanium (PubChem CID 7553123) has the molecular formula C19H34NO+ and a molecular weight of 292.49 g/mol. Its IUPAC name is [(3S)-3-(furan-2-yl)-6-methylheptyl]-(4-methylcyclohexyl)azanium.
| Compound Name | [(3S)-3-(furan-2-yl)-6-methylheptyl]-(4-methylcyclohexyl)azanium |
|---|---|
| PubChem CID | 7553123 |
| Molecular Formula | C19H34NO+ |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | [(3S)-3-(furan-2-yl)-6-methylheptyl]-(4-methylcyclohexyl)azanium |
| SMILES | CC(C)CC[C@@H](CC[NH2+]C1CCC(C)CC1)c1ccco1 |
| InChI | InChI=1S/C19H33NO/c1-15(2)6-9-17(19-5-4-14-21-19)12-13-20-18-10-7-16(3)8-11-18/h4-5,14-18,20H,6-13H2,1-3H3/p+1/t16?,17-,18?/m0/s1 |
| InChIKey | GLJNQSIDBZLUQA-ADKAHSJRSA-O |
| XLogP | 4.33 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |