About (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine
(E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine (PubChem CID 7095027) has the molecular formula C21H33NO
and a molecular weight of 315.50 g/mol. Its IUPAC name is (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine |
| PubChem CID | 7095027 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine |
| SMILES | CC(C)[C@]1(CCNC/C=C/c2ccccc2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C21H33NO/c1-18(2)21(13-16-23-20(3,4)17-21)12-15-22-14-8-11-19-9-6-5-7-10-19/h5-11,18,22H,12-17H2,1-4H3/b11-8+/t21-/m1/s1 |
| InChIKey | RZZSOZXENAQHQI-OGECGYFKSA-N |
| XLogP | 4.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine?
The IUPAC name of (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine (CID 7095027) is (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine.
What is the SMILES notation for (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine?
The canonical SMILES for (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine is CC(C)[C@]1(CCNC/C=C/c2ccccc2)CCOC(C)(C)C1.
What is the InChIKey of (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine?
The InChIKey is RZZSOZXENAQHQI-OGECGYFKSA-N. The full InChI is InChI=1S/C21H33NO/c1-18(2)21(13-16-23-20(3,4)17-21)12-15-22-14-8-11-19-9-6-5-7-10-19/h5-11,18,22H,12-17H2,1-4H3/b11-8+/t21-/m1/s1.
What are the key properties of (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine?
(E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine has a molecular weight of 315.50 g/mol, XLogP of 4.91, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[2-[(4R)-2,2-dimethyl-4-propan-2-yloxan-4-yl]ethyl]-3-phenylprop-2-en-1-amine is sourced from PubChem (CID 7095027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).