C19H25NO8S — CID 102497924
dimethyl 2-[(2S,5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]-1-methylsulfonyl-2,5-dihydropyrrol-2-yl]propanedioate (PubChem CID 102497924) has the molecular formula C19H25NO8S and a molecular weight of 427.48 g/mol. Its IUPAC name is dimethyl 2-[(2S,5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]-1-methylsulfonyl-2,5-dihydropyrrol-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]-1-methylsulfonyl-2,5-dihydropyrrol-2-yl]propanedioate |
|---|---|
| PubChem CID | 102497924 |
| Molecular Formula | C19H25NO8S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | dimethyl 2-[(2S,5R)-5-[(1S)-1-hydroxy-2-phenylmethoxyethyl]-1-methylsulfonyl-2,5-dihydropyrrol-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C=C[C@H]([C@H](O)COCc2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C19H25NO8S/c1-26-18(22)17(19(23)27-2)15-10-9-14(20(15)29(3,24)25)16(21)12-28-11-13-7-5-4-6-8-13/h4-10,14-17,21H,11-12H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | AKOJWEZQTHMRET-OWCLPIDISA-N |
| XLogP | 0.09 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|