C17H24O3 — CID 10492730
methyl (2R,3R)-2-ethyl-4-methyl-3-(phenylmethoxymethyl)pent-4-enoate (PubChem CID 10492730) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl (2R,3R)-2-ethyl-4-methyl-3-(phenylmethoxymethyl)pent-4-enoate.
| Compound Name | methyl (2R,3R)-2-ethyl-4-methyl-3-(phenylmethoxymethyl)pent-4-enoate |
|---|---|
| PubChem CID | 10492730 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | methyl (2R,3R)-2-ethyl-4-methyl-3-(phenylmethoxymethyl)pent-4-enoate |
| SMILES | C=C(C)[C@H](COCc1ccccc1)[C@@H](CC)C(=O)OC |
| InChI | InChI=1S/C17H24O3/c1-5-15(17(18)19-4)16(13(2)3)12-20-11-14-9-7-6-8-10-14/h6-10,15-16H,2,5,11-12H2,1,3-4H3/t15-,16+/m1/s1 |
| InChIKey | KOLKZZJRSSGEPX-CVEARBPZSA-N |
| XLogP | 3.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|