C23H36N3O2+3 — CID 7859082
2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl-[(2R)-2-hydroxy-3-phenylmethoxypropyl]azanium (PubChem CID 7859082) has the molecular formula C23H36N3O2+3 and a molecular weight of 386.56 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl-[(2R)-2-hydroxy-3-phenylmethoxypropyl]azanium.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl-[(2R)-2-hydroxy-3-phenylmethoxypropyl]azanium |
|---|---|
| PubChem CID | 7859082 |
| Molecular Formula | C23H36N3O2+3 |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)ethyl-[(2R)-2-hydroxy-3-phenylmethoxypropyl]azanium |
| SMILES | O[C@H](C[NH2+]CC[NH+]1CC[NH+](Cc2ccccc2)CC1)COCc1ccccc1 |
| InChI | InChI=1S/C23H33N3O2/c27-23(20-28-19-22-9-5-2-6-10-22)17-24-11-12-25-13-15-26(16-14-25)18-21-7-3-1-4-8-21/h1-10,23-24,27H,11-20H2/p+3/t23-/m1/s1 |
| InChIKey | IBCNZEKXJOROFO-HSZRJFAPSA-Q |
| XLogP | -1.89 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|