C14H22Cl2N2 — CID 86647688
5-benzyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,4-c]pyridine-2,5-diium dichloride (PubChem CID 86647688) has the molecular formula C14H22Cl2N2 and a molecular weight of 289.25 g/mol. Its IUPAC name is 5-benzyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,4-c]pyridine-2,5-diium dichloride.
| Compound Name | 5-benzyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,4-c]pyridine-2,5-diium dichloride |
|---|---|
| PubChem CID | 86647688 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-benzyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,4-c]pyridine-2,5-diium dichloride |
| SMILES | [Cl-].[Cl-].c1ccc(C[NH+]2CCC3C[NH2+]CC3C2)cc1 |
| InChI | InChI=1S/C14H20N2.2ClH/c1-2-4-12(5-3-1)10-16-7-6-13-8-15-9-14(13)11-16;;/h1-5,13-15H,6-11H2;2*1H |
| InChIKey | OEWHELIXXBKVDA-UHFFFAOYSA-N |
| XLogP | -6.71 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |