C22H36N2+2 — CID 6982860
1-benzyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine-1,4-diium (PubChem CID 6982860) has the molecular formula C22H36N2+2 and a molecular weight of 328.54 g/mol. Its IUPAC name is 1-benzyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6982860 |
| Molecular Formula | C22H36N2+2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 1-benzyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine-1,4-diium |
| SMILES | CC1=C(CC[NH+]2CC[NH+](Cc3ccccc3)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H34N2/c1-19-8-7-12-22(2,3)21(19)11-13-23-14-16-24(17-15-23)18-20-9-5-4-6-10-20/h4-6,9-10H,7-8,11-18H2,1-3H3/p+2 |
| InChIKey | DWFYPFIAJXBCGA-UHFFFAOYSA-P |
| XLogP | 1.89 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|