C22H32O — CID 151007531
2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-enoxy]ethylbenzene (PubChem CID 151007531) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-enoxy]ethylbenzene.
| Compound Name | 2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-enoxy]ethylbenzene |
|---|---|
| PubChem CID | 151007531 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-[2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-1-enoxy]ethylbenzene |
| SMILES | CC(=COCCc1ccccc1)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H32O/c1-18(17-23-16-14-20-10-6-5-7-11-20)12-13-21-19(2)9-8-15-22(21,3)4/h5-7,10-11,17H,8-9,12-16H2,1-4H3 |
| InChIKey | LVKHAHZKSAJBKM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|