C21H32N2 — CID 1375631
1-phenyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine (PubChem CID 1375631) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-phenyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine.
| Compound Name | 1-phenyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 1375631 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1-phenyl-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine |
| SMILES | CC1=C(CCN2CCN(c3ccccc3)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H32N2/c1-18-8-7-12-21(2,3)20(18)11-13-22-14-16-23(17-15-22)19-9-5-4-6-10-19/h4-6,9-10H,7-8,11-17H2,1-3H3 |
| InChIKey | JGABPTPSCQTIIC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|