C21H31FN2 — CID 23855023
1-(2-fluorophenyl)-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine (PubChem CID 23855023) has the molecular formula C21H31FN2 and a molecular weight of 330.49 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine.
| Compound Name | 1-(2-fluorophenyl)-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 23855023 |
| Molecular Formula | C21H31FN2 |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]piperazine |
| SMILES | CC1=C(CCN2CCN(c3ccccc3F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H31FN2/c1-17-7-6-11-21(2,3)18(17)10-12-23-13-15-24(16-14-23)20-9-5-4-8-19(20)22/h4-5,8-9H,6-7,10-16H2,1-3H3 |
| InChIKey | OTPUVJHZBSCSAV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|