C22H36N4O — CID 162628784
2-(oxan-4-yl)-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine (PubChem CID 162628784) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 2-(oxan-4-yl)-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine.
| Compound Name | 2-(oxan-4-yl)-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 162628784 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 2-(oxan-4-yl)-7-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
| SMILES | CC1=C(CCN2CCc3nc(C4CCOCC4)nn3CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H36N4O/c1-17-5-4-10-22(2,3)19(17)6-11-25-12-7-20-23-21(24-26(20)14-13-25)18-8-15-27-16-9-18/h18H,4-16H2,1-3H3 |
| InChIKey | NIGYDNXILWTPRW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|