C21H32N4O — CID 162635567
7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine (PubChem CID 162635567) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine.
| Compound Name | 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
|---|---|
| PubChem CID | 162635567 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2-(oxan-4-yl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCc4nc(C5CCOCC5)nn4CC3)[C@@H]1C2 |
| InChI | InChI=1S/C21H32N4O/c1-21(2)17-4-3-16(18(21)13-17)14-24-8-5-19-22-20(23-25(19)10-9-24)15-6-11-26-12-7-15/h3,15,17-18H,4-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | FDIXLVORZDHBFN-ROUUACIJSA-N |
| XLogP | 3.02 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|