C16H24N4 — CID 42418690
7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 42418690) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 42418690 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCc4nncn4CC3)[C@@H]1C2 |
| InChI | InChI=1S/C16H24N4/c1-16(2)13-4-3-12(14(16)9-13)10-19-6-5-15-18-17-11-20(15)8-7-19/h3,11,13-14H,4-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | XWXUJQOBJGHUBV-KBPBESRZSA-N |
| XLogP | 2.13 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|