C25H41N3O2+2 — CID 23375786
(2R)-1-[4-(2-phenylethyl)piperazine-1,4-diium-1-yl]-3-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 23375786) has the molecular formula C25H41N3O2+2 and a molecular weight of 415.62 g/mol. Its IUPAC name is (2R)-1-[4-(2-phenylethyl)piperazine-1,4-diium-1-yl]-3-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | (2R)-1-[4-(2-phenylethyl)piperazine-1,4-diium-1-yl]-3-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 23375786 |
| Molecular Formula | C25H41N3O2+2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | (2R)-1-[4-(2-phenylethyl)piperazine-1,4-diium-1-yl]-3-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N\OC[C@H](O)C[NH+]1CC[NH+](CCc3ccccc3)CC1)C2 |
| InChI | InChI=1S/C25H39N3O2/c1-24(2)21-9-11-25(24,3)23(17-21)26-30-19-22(29)18-28-15-13-27(14-16-28)12-10-20-7-5-4-6-8-20/h4-8,21-22,29H,9-19H2,1-3H3/p+2/b26-23-/t21-,22+,25-/m0/s1 |
| InChIKey | OYORAXCOEWWKBH-PMJHYQNMSA-P |
| XLogP | 0.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|