C19H21FN2O3 — CID 7261343
2-ethoxyethyl N'-benzyl-N-(2-fluorobenzoyl)carbamimidate (PubChem CID 7261343) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-ethoxyethyl N'-benzyl-N-(2-fluorobenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-benzyl-N-(2-fluorobenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7261343 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-ethoxyethyl N'-benzyl-N-(2-fluorobenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\Cc1ccccc1)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H21FN2O3/c1-2-24-12-13-25-19(21-14-15-8-4-3-5-9-15)22-18(23)16-10-6-7-11-17(16)20/h3-11H,2,12-14H2,1H3,(H,21,22,23) |
| InChIKey | QCNOWWQSAJVSJX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|