C20H21FN2O5 — CID 46125629
2-ethoxyethyl N'-(1,3-benzodioxol-5-ylmethyl)-N-(2-fluorobenzoyl)carbamimidate (PubChem CID 46125629) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-ethoxyethyl N'-(1,3-benzodioxol-5-ylmethyl)-N-(2-fluorobenzoyl)carbamimidate.
| Compound Name | 2-ethoxyethyl N'-(1,3-benzodioxol-5-ylmethyl)-N-(2-fluorobenzoyl)carbamimidate |
|---|---|
| PubChem CID | 46125629 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-ethoxyethyl N'-(1,3-benzodioxol-5-ylmethyl)-N-(2-fluorobenzoyl)carbamimidate |
| SMILES | CCOCCO/C(=N\Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H21FN2O5/c1-2-25-9-10-26-20(23-19(24)15-5-3-4-6-16(15)21)22-12-14-7-8-17-18(11-14)28-13-27-17/h3-8,11H,2,9-10,12-13H2,1H3,(H,22,23,24) |
| InChIKey | ACBCASUOUWKJFL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|