C21H28IN3O3 — CID 111846256
2-(1,3-benzodioxol-5-ylmethyl)-1-[[2-(ethoxymethyl)phenyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111846256) has the molecular formula C21H28IN3O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-[[2-(ethoxymethyl)phenyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[[2-(ethoxymethyl)phenyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111846256 |
| Molecular Formula | C21H28IN3O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[[2-(ethoxymethyl)phenyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccccc1COCC.I |
| InChI | InChI=1S/C21H27N3O3.HI/c1-3-22-21(23-12-16-9-10-19-20(11-16)27-15-26-19)24-13-17-7-5-6-8-18(17)14-25-4-2;/h5-11H,3-4,12-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | OWSPCNMOMOYPQP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|