C23H22BrN3O4S — CID 26169328
N-[3-[[3-bromo-4-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 26169328) has the molecular formula C23H22BrN3O4S and a molecular weight of 516.42 g/mol. Its IUPAC name is N-[3-[[3-bromo-4-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-bromo-4-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26169328 |
| Molecular Formula | C23H22BrN3O4S |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | N-[3-[[3-bromo-4-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccco3)c2)cc1Br |
| InChI | InChI=1S/C23H22BrN3O4S/c1-14(2)13-31-19-9-8-15(11-18(19)24)21(28)27-23(32)26-17-6-3-5-16(12-17)25-22(29)20-7-4-10-30-20/h3-12,14H,13H2,1-2H3,(H,25,29)(H2,26,27,28,32) |
| InChIKey | PPFPKOKMUBXJEX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|