C21H25BrN2O4S — CID 17079943
3-bromo-4-(2-methoxyethoxy)-N-[[3-(2-methylpropoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17079943) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N-[[3-(2-methylpropoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N-[[3-(2-methylpropoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17079943 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N-[[3-(2-methylpropoxy)phenyl]carbamothioyl]benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)Nc2cccc(OCC(C)C)c2)cc1Br |
| InChI | InChI=1S/C21H25BrN2O4S/c1-14(2)13-28-17-6-4-5-16(12-17)23-21(29)24-20(25)15-7-8-19(18(22)11-15)27-10-9-26-3/h4-8,11-12,14H,9-10,13H2,1-3H3,(H2,23,24,25,29) |
| InChIKey | DZDAXGZSCUSISW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|