C17H21N3O5S — CID 24635381
N-[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl]furan-2-carboxamide (PubChem CID 24635381) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24635381 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)C(C)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-11(2)20-26(23,24)14-8-6-13(7-9-14)19-16(21)12(3)18-17(22)15-5-4-10-25-15/h4-12,20H,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | QPNWIRAYJLZOEI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |