C20H29NO2S — CID 19681569
N-[1-(1-adamantyl)ethyl]-4-ethylbenzenesulfonamide (PubChem CID 19681569) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19681569 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-3-15-4-6-19(7-5-15)24(22,23)21-14(2)20-11-16-8-17(12-20)10-18(9-16)13-20/h4-7,14,16-18,21H,3,8-13H2,1-2H3 |
| InChIKey | ILFINQKFGYZGHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |