C22H30NO4S- — CID 7970952
(2R)-2-(1-adamantyl)-2-[(4-butylphenyl)sulfonylamino]acetate (PubChem CID 7970952) has the molecular formula C22H30NO4S- and a molecular weight of 404.55 g/mol. Its IUPAC name is (2R)-2-(1-adamantyl)-2-[(4-butylphenyl)sulfonylamino]acetate.
| Compound Name | (2R)-2-(1-adamantyl)-2-[(4-butylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7970952 |
| Molecular Formula | C22H30NO4S- |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2R)-2-(1-adamantyl)-2-[(4-butylphenyl)sulfonylamino]acetate |
| SMILES | CCCCc1ccc(S(=O)(=O)N[C@@H](C(=O)[O-])C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H31NO4S/c1-2-3-4-15-5-7-19(8-6-15)28(26,27)23-20(21(24)25)22-12-16-9-17(13-22)11-18(10-16)14-22/h5-8,16-18,20,23H,2-4,9-14H2,1H3,(H,24,25)/p-1/t16?,17?,18?,20-,22?/m0/s1 |
| InChIKey | NJYSJLWXAIVDBW-BUMILGAPSA-M |
| XLogP | 2.64 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |