C21H29NO4S — CID 7063115
(2S)-2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid (PubChem CID 7063115) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is (2S)-2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid.
| Compound Name | (2S)-2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 7063115 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (2S)-2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)N[C@H](C(=O)O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H29NO4S/c1-13(2)17-3-5-18(6-4-17)27(25,26)22-19(20(23)24)21-10-14-7-15(11-21)9-16(8-14)12-21/h3-6,13-16,19,22H,7-12H2,1-2H3,(H,23,24)/t14?,15?,16?,19-,21?/m1/s1 |
| InChIKey | NVHWFSUIZAQYPP-KXDMBUCYSA-N |
| XLogP | 3.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |