C16H27N2O2S+ — CID 68847871
N-(1,1-dimethylazetidin-1-ium-3-yl)-4-pentylbenzenesulfonamide (PubChem CID 68847871) has the molecular formula C16H27N2O2S+ and a molecular weight of 311.47 g/mol. Its IUPAC name is N-(1,1-dimethylazetidin-1-ium-3-yl)-4-pentylbenzenesulfonamide.
| Compound Name | N-(1,1-dimethylazetidin-1-ium-3-yl)-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 68847871 |
| Molecular Formula | C16H27N2O2S+ |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-(1,1-dimethylazetidin-1-ium-3-yl)-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NC2C[N+](C)(C)C2)cc1 |
| InChI | InChI=1S/C16H27N2O2S/c1-4-5-6-7-14-8-10-16(11-9-14)21(19,20)17-15-12-18(2,3)13-15/h8-11,15,17H,4-7,12-13H2,1-3H3/q+1 |
| InChIKey | FMSDWJGDGJGLJD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|