C23H35NO2S — CID 22201482
N-[1-(1-adamantyl)propyl]-4-tert-butylbenzenesulfonamide (PubChem CID 22201482) has the molecular formula C23H35NO2S and a molecular weight of 389.61 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 22201482 |
| Molecular Formula | C23H35NO2S |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-4-tert-butylbenzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H35NO2S/c1-5-21(23-13-16-10-17(14-23)12-18(11-16)15-23)24-27(25,26)20-8-6-19(7-9-20)22(2,3)4/h6-9,16-18,21,24H,5,10-15H2,1-4H3 |
| InChIKey | BRXPXSVERUXYNU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |