C17H24ClNO2S2 — CID 22201496
N-[1-(1-adamantyl)propyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 22201496) has the molecular formula C17H24ClNO2S2 and a molecular weight of 373.97 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22201496 |
| Molecular Formula | C17H24ClNO2S2 |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(Cl)s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H24ClNO2S2/c1-2-14(19-23(20,21)16-4-3-15(18)22-16)17-8-11-5-12(9-17)7-13(6-11)10-17/h3-4,11-14,19H,2,5-10H2,1H3 |
| InChIKey | JIVJPDPLVYLNNX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |