C11H19ClNNaO6S3 — CID 87610468
sodium;5-chloro-N-(3-ethylpentan-2-yl)thiophene-2-sulfonamide;sulfuric acid (PubChem CID 87610468) has the molecular formula C11H19ClNNaO6S3 and a molecular weight of 415.92 g/mol. Its IUPAC name is sodium;5-chloro-N-(3-ethylpentan-2-yl)thiophene-2-sulfonamide;sulfuric acid.
| Compound Name | sodium;5-chloro-N-(3-ethylpentan-2-yl)thiophene-2-sulfonamide;sulfuric acid |
|---|---|
| PubChem CID | 87610468 |
| Molecular Formula | C11H19ClNNaO6S3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | sodium;5-chloro-N-(3-ethylpentan-2-yl)thiophene-2-sulfonamide;sulfuric acid |
| SMILES | O=S(=O)(O)O.[CH2-]C(NS(=O)(=O)c1ccc(Cl)s1)C(CC)CC.[Na+] |
| InChI | InChI=1S/C11H17ClNO2S2.Na.H2O4S/c1-4-9(5-2)8(3)13-17(14,15)11-7-6-10(12)16-11;;1-5(2,3)4/h6-9,13H,3-5H2,1-2H3;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | UOKFPAZXNKHKRF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|