C21H31NO2S — CID 22201487
N-[1-(1-adamantyl)propyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 22201487) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22201487 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(C)cc1C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31NO2S/c1-4-20(21-11-16-8-17(12-21)10-18(9-16)13-21)22-25(23,24)19-6-5-14(2)7-15(19)3/h5-7,16-18,20,22H,4,8-13H2,1-3H3 |
| InChIKey | IMZAJFBCJFOEKN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |