C19H26N2O4S — CID 9283324
N-[(1S)-1-(1-adamantyl)ethyl]-4-methylsulfonyl-2-nitroaniline (PubChem CID 9283324) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 9283324 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
| SMILES | C[C@H](Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26N2O4S/c1-12(19-9-13-5-14(10-19)7-15(6-13)11-19)20-17-4-3-16(26(2,24)25)8-18(17)21(22)23/h3-4,8,12-15,20H,5-7,9-11H2,1-2H3/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | GUJHYVFVVCQRLW-UHSVVUDUSA-N |
| XLogP | 4.02 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|