C16H22N2O4S — CID 51160232
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-methylsulfonyl-2-nitroaniline (PubChem CID 51160232) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 51160232 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-methylsulfonyl-2-nitroaniline |
| SMILES | CC(Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C1CC2CCC1C2 |
| InChI | InChI=1S/C16H22N2O4S/c1-10(14-8-11-3-4-12(14)7-11)17-15-6-5-13(23(2,21)22)9-16(15)18(19)20/h5-6,9-12,14,17H,3-4,7-8H2,1-2H3 |
| InChIKey | DYROZRXAUNMULT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|