C19H24F3N3O3 — CID 98649783
(2S)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 98649783) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | (2S)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 98649783 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2S)-N-[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | C[C@H](Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)N[C@H](C)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H24F3N3O3/c1-10(15-8-12-3-4-13(15)7-12)24-18(26)11(2)23-16-6-5-14(19(20,21)22)9-17(16)25(27)28/h5-6,9-13,15,23H,3-4,7-8H2,1-2H3,(H,24,26)/t10-,11+,12+,13+,15+/m1/s1 |
| InChIKey | VTMNLTYPYBEUOM-MCZMQQNQSA-N |
| XLogP | 4.35 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|