C14H20N2O4S — CID 103742861
4-methylsulfonyl-2-nitro-N-[(1-propan-2-ylcyclopropyl)methyl]aniline (PubChem CID 103742861) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-methylsulfonyl-2-nitro-N-[(1-propan-2-ylcyclopropyl)methyl]aniline.
| Compound Name | 4-methylsulfonyl-2-nitro-N-[(1-propan-2-ylcyclopropyl)methyl]aniline |
|---|---|
| PubChem CID | 103742861 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-methylsulfonyl-2-nitro-N-[(1-propan-2-ylcyclopropyl)methyl]aniline |
| SMILES | CC(C)C1(CNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H20N2O4S/c1-10(2)14(6-7-14)9-15-12-5-4-11(21(3,19)20)8-13(12)16(17)18/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | IBZRIALGYMKBKJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|