C16H25N3O4S — CID 51964340
N-[(2S)-2-methyl-3-piperidin-1-ylpropyl]-4-methylsulfonyl-2-nitroaniline (PubChem CID 51964340) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[(2S)-2-methyl-3-piperidin-1-ylpropyl]-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[(2S)-2-methyl-3-piperidin-1-ylpropyl]-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 51964340 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[(2S)-2-methyl-3-piperidin-1-ylpropyl]-4-methylsulfonyl-2-nitroaniline |
| SMILES | C[C@@H](CNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])CN1CCCCC1 |
| InChI | InChI=1S/C16H25N3O4S/c1-13(12-18-8-4-3-5-9-18)11-17-15-7-6-14(24(2,22)23)10-16(15)19(20)21/h6-7,10,13,17H,3-5,8-9,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | COZMXYDJVSYENL-ZDUSSCGKSA-N |
| XLogP | 2.53 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|