C13H19N3O5S — CID 133388157
N,3-dimethyl-2-(4-methylsulfonyl-2-nitroanilino)butanamide (PubChem CID 133388157) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is N,3-dimethyl-2-(4-methylsulfonyl-2-nitroanilino)butanamide.
| Compound Name | N,3-dimethyl-2-(4-methylsulfonyl-2-nitroanilino)butanamide |
|---|---|
| PubChem CID | 133388157 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N,3-dimethyl-2-(4-methylsulfonyl-2-nitroanilino)butanamide |
| SMILES | CNC(=O)C(Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C13H19N3O5S/c1-8(2)12(13(17)14-3)15-10-6-5-9(22(4,20)21)7-11(10)16(18)19/h5-8,12,15H,1-4H3,(H,14,17) |
| InChIKey | ZJQIAVMBSQYZDZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|