C18H11ClN2O5 — CID 2028582
(6aS)-5-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 2028582) has the molecular formula C18H11ClN2O5 and a molecular weight of 370.75 g/mol. Its IUPAC name is (6aS)-5-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (6aS)-5-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 2028582 |
| Molecular Formula | C18H11ClN2O5 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (6aS)-5-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2=C(c3ccc(Cl)cc3)NO[C@@H]2C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H11ClN2O5/c19-10-3-1-9(2-4-10)15-14-16(26-20-15)18(23)21(17(14)22)11-5-6-12-13(7-11)25-8-24-12/h1-7,16,20H,8H2/t16-/m0/s1 |
| InChIKey | ZTRJJBIJMLLSAL-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|