C18H10Cl2N2O5 — CID 6577703
(6aR)-5-(1,3-benzodioxol-5-yl)-3-(2,4-dichlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 6577703) has the molecular formula C18H10Cl2N2O5 and a molecular weight of 405.19 g/mol. Its IUPAC name is (6aR)-5-(1,3-benzodioxol-5-yl)-3-(2,4-dichlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (6aR)-5-(1,3-benzodioxol-5-yl)-3-(2,4-dichlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 6577703 |
| Molecular Formula | C18H10Cl2N2O5 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | (6aR)-5-(1,3-benzodioxol-5-yl)-3-(2,4-dichlorophenyl)-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2=C(c3ccc(Cl)cc3Cl)NO[C@H]2C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H10Cl2N2O5/c19-8-1-3-10(11(20)5-8)15-14-16(27-21-15)18(24)22(17(14)23)9-2-4-12-13(6-9)26-7-25-12/h1-6,16,21H,7H2/t16-/m1/s1 |
| InChIKey | OLEBEQMDWIEVSQ-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|