C18H15ClN2O4 — CID 95182861
(1R,9R)-10-(1,3-benzodioxol-5-yl)-4-chloro-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 95182861) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is (1R,9R)-10-(1,3-benzodioxol-5-yl)-4-chloro-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1R,9R)-10-(1,3-benzodioxol-5-yl)-4-chloro-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 95182861 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (1R,9R)-10-(1,3-benzodioxol-5-yl)-4-chloro-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | C[C@@]12C[C@@H](NC(=O)N1c1ccc3c(c1)OCO3)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C18H15ClN2O4/c1-18-8-13(12-6-10(19)2-4-14(12)25-18)20-17(22)21(18)11-3-5-15-16(7-11)24-9-23-15/h2-7,13H,8-9H2,1H3,(H,20,22)/t13-,18-/m1/s1 |
| InChIKey | LHNBMYAXVXYBSM-FZKQIMNGSA-N |
| XLogP | 3.84 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |