C22H18N2O4 — CID 95796673
(1R,13R)-14-(1,3-benzodioxol-5-yl)-13-methyl-12-oxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3,5,7,9-pentaen-15-one (PubChem CID 95796673) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is (1R,13R)-14-(1,3-benzodioxol-5-yl)-13-methyl-12-oxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3,5,7,9-pentaen-15-one.
| Compound Name | (1R,13R)-14-(1,3-benzodioxol-5-yl)-13-methyl-12-oxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3,5,7,9-pentaen-15-one |
|---|---|
| PubChem CID | 95796673 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (1R,13R)-14-(1,3-benzodioxol-5-yl)-13-methyl-12-oxa-14,16-diazatetracyclo[11.3.1.02,11.03,8]heptadeca-2(11),3,5,7,9-pentaen-15-one |
| SMILES | C[C@@]12C[C@@H](NC(=O)N1c1ccc3c(c1)OCO3)c1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C22H18N2O4/c1-22-11-16(20-15-5-3-2-4-13(15)6-8-18(20)28-22)23-21(25)24(22)14-7-9-17-19(10-14)27-12-26-17/h2-10,16H,11-12H2,1H3,(H,23,25)/t16-,22-/m1/s1 |
| InChIKey | PRXITLGYOUJITC-OPAMFIHVSA-N |
| XLogP | 4.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |