C26H25N3O3 — CID 98207701
4-[(1S,9R)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 98207701) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-[(1S,9R)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 4-[(1S,9R)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 98207701 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-[(1S,9R)-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(N3C(=O)N[C@H]4C[C@@]3(C)Oc3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-17-7-9-18(10-8-17)16-27-24(30)19-11-13-20(14-12-19)29-25(31)28-22-15-26(29,2)32-23-6-4-3-5-21(22)23/h3-14,22H,15-16H2,1-2H3,(H,27,30)(H,28,31)/t22-,26+/m0/s1 |
| InChIKey | AMLDNEPTCICLQD-BKMJKUGQSA-N |
| XLogP | 4.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |